C23H19F2NO3 — CID 71225512
5-(2,6-dioxocyclohexyl)-2-(3-fluorophenyl)-3-(4-fluorophenyl)-5-oxopentanenitrile (PubChem CID 71225512) has the molecular formula C23H19F2NO3 and a molecular weight of 395.41 g/mol. Its IUPAC name is 5-(2,6-dioxocyclohexyl)-2-(3-fluorophenyl)-3-(4-fluorophenyl)-5-oxopentanenitrile.
| Compound Name | 5-(2,6-dioxocyclohexyl)-2-(3-fluorophenyl)-3-(4-fluorophenyl)-5-oxopentanenitrile |
|---|---|
| PubChem CID | 71225512 |
| Molecular Formula | C23H19F2NO3 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 5-(2,6-dioxocyclohexyl)-2-(3-fluorophenyl)-3-(4-fluorophenyl)-5-oxopentanenitrile |
| SMILES | N#CC(c1cccc(F)c1)C(CC(=O)C1C(=O)CCCC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19F2NO3/c24-16-9-7-14(8-10-16)18(19(13-26)15-3-1-4-17(25)11-15)12-22(29)23-20(27)5-2-6-21(23)28/h1,3-4,7-11,18-19,23H,2,5-6,12H2 |
| InChIKey | MYGXVTNPMNHZGO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|