C19H23N — CID 71234807
6-cyclohex-2-en-1-yl-1-methyl-2,4b,8a,9-tetrahydro-1H-carbazole (PubChem CID 71234807) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 6-cyclohex-2-en-1-yl-1-methyl-2,4b,8a,9-tetrahydro-1H-carbazole.
| Compound Name | 6-cyclohex-2-en-1-yl-1-methyl-2,4b,8a,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 71234807 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6-cyclohex-2-en-1-yl-1-methyl-2,4b,8a,9-tetrahydro-1H-carbazole |
| SMILES | CC1CC=CC2=C1NC1C=CC(C3C=CCCC3)=CC21 |
| InChI | InChI=1S/C19H23N/c1-13-6-5-9-16-17-12-15(14-7-3-2-4-8-14)10-11-18(17)20-19(13)16/h3,5,7,9-14,17-18,20H,2,4,6,8H2,1H3 |
| InChIKey | HJKUVCOWZDBHIS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|