C19H21N5O2 — CID 71240151
1-methyl-3-oxo-2-(1-pyridin-4-ylpiperidin-4-yl)indazole-4-carboxamide (PubChem CID 71240151) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-methyl-3-oxo-2-(1-pyridin-4-ylpiperidin-4-yl)indazole-4-carboxamide.
| Compound Name | 1-methyl-3-oxo-2-(1-pyridin-4-ylpiperidin-4-yl)indazole-4-carboxamide |
|---|---|
| PubChem CID | 71240151 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-methyl-3-oxo-2-(1-pyridin-4-ylpiperidin-4-yl)indazole-4-carboxamide |
| SMILES | Cn1c2cccc(C(N)=O)c2c(=O)n1C1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C19H21N5O2/c1-22-16-4-2-3-15(18(20)25)17(16)19(26)24(22)14-7-11-23(12-8-14)13-5-9-21-10-6-13/h2-6,9-10,14H,7-8,11-12H2,1H3,(H2,20,25) |
| InChIKey | ISZXVGQBWFOMRH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |