C16H27N3O7S2 — CID 71245279
N-[2-(1,1-dihydroxy-1,4-thiazinan-4-yl)ethyl]-N-(3-methoxypropyl)-2-nitrobenzenesulfonamide (PubChem CID 71245279) has the molecular formula C16H27N3O7S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[2-(1,1-dihydroxy-1,4-thiazinan-4-yl)ethyl]-N-(3-methoxypropyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(1,1-dihydroxy-1,4-thiazinan-4-yl)ethyl]-N-(3-methoxypropyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 71245279 |
| Molecular Formula | C16H27N3O7S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[2-(1,1-dihydroxy-1,4-thiazinan-4-yl)ethyl]-N-(3-methoxypropyl)-2-nitrobenzenesulfonamide |
| SMILES | COCCCN(CCN1CCS(O)(O)CC1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H27N3O7S2/c1-26-12-4-7-18(9-8-17-10-13-27(22,23)14-11-17)28(24,25)16-6-3-2-5-15(16)19(20)21/h2-3,5-6,22-23H,4,7-14H2,1H3 |
| InChIKey | BQVSUOQKDCICJR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|