C22H26BrN3O7S — CID 167068643
methyl 1-[2-[(4-bromophenyl)methyl-(2-nitrophenyl)sulfonylamino]ethyl]piperidine-4-carboperoxoate (PubChem CID 167068643) has the molecular formula C22H26BrN3O7S and a molecular weight of 556.44 g/mol. Its IUPAC name is methyl 1-[2-[(4-bromophenyl)methyl-(2-nitrophenyl)sulfonylamino]ethyl]piperidine-4-carboperoxoate.
| Compound Name | methyl 1-[2-[(4-bromophenyl)methyl-(2-nitrophenyl)sulfonylamino]ethyl]piperidine-4-carboperoxoate |
|---|---|
| PubChem CID | 167068643 |
| Molecular Formula | C22H26BrN3O7S |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | methyl 1-[2-[(4-bromophenyl)methyl-(2-nitrophenyl)sulfonylamino]ethyl]piperidine-4-carboperoxoate |
| SMILES | COOC(=O)C1CCN(CCN(Cc2ccc(Br)cc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H26BrN3O7S/c1-32-33-22(27)18-10-12-24(13-11-18)14-15-25(16-17-6-8-19(23)9-7-17)34(30,31)21-5-3-2-4-20(21)26(28)29/h2-9,18H,10-16H2,1H3 |
| InChIKey | CFOLTPSSOKVQCP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|