C27H35Cl3N2O8Si — CID 71250207
2,2,2-trichloroethyl (6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-8-[(E)-3-methoxy-3-oxoprop-1-enyl]-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 71250207) has the molecular formula C27H35Cl3N2O8Si and a molecular weight of 650.03 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-8-[(E)-3-methoxy-3-oxoprop-1-enyl]-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-8-[(E)-3-methoxy-3-oxoprop-1-enyl]-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 71250207 |
| Molecular Formula | C27H35Cl3N2O8Si |
| Molecular Weight | 650.03 g/mol |
| Exact Mass | 648.12 |
| IUPAC Name | 2,2,2-trichloroethyl (6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-8-[(E)-3-methoxy-3-oxoprop-1-enyl]-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | COC(=O)/C=C/C1=CN2C(=O)c3cc(OC)c(OC)cc3N(C(=O)OCC(Cl)(Cl)Cl)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C27H35Cl3N2O8Si/c1-26(2,3)41(7,8)40-24-19-11-16(9-10-22(33)38-6)14-31(19)23(34)17-12-20(36-4)21(37-5)13-18(17)32(24)25(35)39-15-27(28,29)30/h9-10,12-14,19,24H,11,15H2,1-8H3/b10-9+/t19-,24+/m1/s1 |
| InChIKey | GTDQBQLPNJJLLN-UXQSZXOQSA-N |
| XLogP | 6.21 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|