C25H35Cl3N2O8Si — CID 58925969
2,2,2-trichloroethyl (6S,6aS,8R)-8-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 58925969) has the molecular formula C25H35Cl3N2O8Si and a molecular weight of 626.01 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S,6aS,8R)-8-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S,6aS,8R)-8-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 58925969 |
| Molecular Formula | C25H35Cl3N2O8Si |
| Molecular Weight | 626.01 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | 2,2,2-trichloroethyl (6S,6aS,8R)-8-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | COc1cc2c(cc1OC)N(C(=O)OCC(Cl)(Cl)Cl)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H](OC(C)=O)CN1C2=O |
| InChI | InChI=1S/C25H35Cl3N2O8Si/c1-14(31)37-15-9-18-22(38-39(7,8)24(2,3)4)30(23(33)36-13-25(26,27)28)17-11-20(35-6)19(34-5)10-16(17)21(32)29(18)12-15/h10-11,15,18,22H,9,12-13H2,1-8H3/t15-,18+,22+/m1/s1 |
| InChIKey | MMRUZNVDCCHEOW-QRFQSNJMSA-N |
| XLogP | 5.52 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|