C16H26FNO3 — CID 71254298
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-fluoro-2-oxopiperidine-3-carboxylate (PubChem CID 71254298) has the molecular formula C16H26FNO3 and a molecular weight of 299.39 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-fluoro-2-oxopiperidine-3-carboxylate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-fluoro-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 71254298 |
| Molecular Formula | C16H26FNO3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (3S)-3-fluoro-2-oxopiperidine-3-carboxylate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)[C@]1(F)CCCNC1=O |
| InChI | InChI=1S/C16H26FNO3/c1-10(2)12-6-5-11(3)9-13(12)21-15(20)16(17)7-4-8-18-14(16)19/h10-13H,4-9H2,1-3H3,(H,18,19)/t11-,12+,13-,16-/m0/s1 |
| InChIKey | YXKBEPODSVSJND-ZWUHOBOKSA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|