C14H16ClN3O3 — CID 71272416
[6-chloro-1-(oxan-2-yl)benzimidazol-4-yl]methylcarbamic acid (PubChem CID 71272416) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is [6-chloro-1-(oxan-2-yl)benzimidazol-4-yl]methylcarbamic acid.
| Compound Name | [6-chloro-1-(oxan-2-yl)benzimidazol-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 71272416 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | [6-chloro-1-(oxan-2-yl)benzimidazol-4-yl]methylcarbamic acid |
| SMILES | O=C(O)NCc1cc(Cl)cc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C14H16ClN3O3/c15-10-5-9(7-16-14(19)20)13-11(6-10)18(8-17-13)12-3-1-2-4-21-12/h5-6,8,12,16H,1-4,7H2,(H,19,20) |
| InChIKey | SAMRSKYUINOVGW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |