C16H21N3O5 — CID 71273413
[(7R)-7-azido-1,2,3-trimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl] acetate (PubChem CID 71273413) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is [(7R)-7-azido-1,2,3-trimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl] acetate.
| Compound Name | [(7R)-7-azido-1,2,3-trimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl] acetate |
|---|---|
| PubChem CID | 71273413 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [(7R)-7-azido-1,2,3-trimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl] acetate |
| SMILES | COc1cc2c(c(OC)c1OC)CC[C@@H](N=[N+]=[N-])CC2OC(C)=O |
| InChI | InChI=1S/C16H21N3O5/c1-9(20)24-13-7-10(18-19-17)5-6-11-12(13)8-14(21-2)16(23-4)15(11)22-3/h8,10,13H,5-7H2,1-4H3/t10-,13?/m1/s1 |
| InChIKey | NHCARBRJCFFFFH-VUUHIHSGSA-N |
| XLogP | 3.33 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|