C25H24N4O2 — CID 71274689
N-methyl-6-[3-(oxan-3-yloxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71274689) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-methyl-6-[3-(oxan-3-yloxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-methyl-6-[3-(oxan-3-yloxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71274689 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-methyl-6-[3-(oxan-3-yloxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2ccc(-c3cccc(OC4CCCOC4)c3)cc12 |
| InChI | InChI=1S/C25H24N4O2/c1-26-25-22-14-18(9-10-23(22)28-24(29-25)19-6-3-11-27-15-19)17-5-2-7-20(13-17)31-21-8-4-12-30-16-21/h2-3,5-7,9-11,13-15,21H,4,8,12,16H2,1H3,(H,26,28,29) |
| InChIKey | OCFAPEDHGJXLLX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |