C38H32F2N6O2 — CID 71286158
N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-3-carboxamide (PubChem CID 71286158) has the molecular formula C38H32F2N6O2 and a molecular weight of 642.71 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-3-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 71286158 |
| Molecular Formula | C38H32F2N6O2 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1H-indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1nc2c(ccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)nc1-c1n[nH]c2ccc(OC(F)F)cc12 |
| InChI | InChI=1S/C38H32F2N6O2/c1-37(2,3)43-35(47)33-32(31-28-23-27(48-36(39)40)19-20-29(28)44-45-31)41-30-21-22-46(34(30)42-33)38(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-23,36H,1-3H3,(H,43,47)(H,44,45) |
| InChIKey | RDIFYWWHEWBOKY-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|