C15H29NO2 — CID 71315138
(E,7R,8R)-11,12,12,12-tetradeuterio-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one (PubChem CID 71315138) has the molecular formula C15H29NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is (E,7R,8R)-11,12,12,12-tetradeuterio-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one.
| Compound Name | (E,7R,8R)-11,12,12,12-tetradeuterio-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one |
|---|---|
| PubChem CID | 71315138 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.24 |
| IUPAC Name | (E,7R,8R)-11,12,12,12-tetradeuterio-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one |
| SMILES | [2H]/C(=C\C[C@@H](C)[C@@H](O)C(C(=O)CCCC)N(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H29NO2/c1-6-8-10-12(3)15(18)14(16(4)5)13(17)11-9-7-2/h6,8,12,14-15,18H,7,9-11H2,1-5H3/b8-6+/t12-,14?,15-/m1/s1/i1D3,6D |
| InChIKey | DPAAIHLBLZXPBQ-DEDZMNNOSA-N |
| XLogP | 2.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|