C12H17N3+2 — CID 7131848
(2R)-2-phenyl-2-piperazine-1,4-diium-1-ylacetonitrile (PubChem CID 7131848) has the molecular formula C12H17N3+2 and a molecular weight of 203.29 g/mol. Its IUPAC name is (2R)-2-phenyl-2-piperazine-1,4-diium-1-ylacetonitrile.
| Compound Name | (2R)-2-phenyl-2-piperazine-1,4-diium-1-ylacetonitrile |
|---|---|
| PubChem CID | 7131848 |
| Molecular Formula | C12H17N3+2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (2R)-2-phenyl-2-piperazine-1,4-diium-1-ylacetonitrile |
| SMILES | N#C[C@@H](c1ccccc1)[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C12H15N3/c13-10-12(11-4-2-1-3-5-11)15-8-6-14-7-9-15/h1-5,12,14H,6-9H2/p+2/t12-/m0/s1 |
| InChIKey | BHGROGKAGDDTQA-LBPRGKRZSA-P |
| XLogP | -1.29 |
| TPSA | 44.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |