C11H10O3S — CID 71326877
(1,1-dioxo-2,3-dihydrothiophen-3-yl)-phenylmethanone (PubChem CID 71326877) has the molecular formula C11H10O3S and a molecular weight of 222.27 g/mol. Its IUPAC name is (1,1-dioxo-2,3-dihydrothiophen-3-yl)-phenylmethanone.
| Compound Name | (1,1-dioxo-2,3-dihydrothiophen-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 71326877 |
| Molecular Formula | C11H10O3S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (1,1-dioxo-2,3-dihydrothiophen-3-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H10O3S/c12-11(9-4-2-1-3-5-9)10-6-7-15(13,14)8-10/h1-7,10H,8H2 |
| InChIKey | DLXIMBOFOHWHDK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |