C20H13NO2S3 — CID 71360551
3-[2-(4-nitrophenyl)ethenyl]-2,5-dithiophen-2-ylthiophene (PubChem CID 71360551) has the molecular formula C20H13NO2S3 and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-[2-(4-nitrophenyl)ethenyl]-2,5-dithiophen-2-ylthiophene.
| Compound Name | 3-[2-(4-nitrophenyl)ethenyl]-2,5-dithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 71360551 |
| Molecular Formula | C20H13NO2S3 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 3-[2-(4-nitrophenyl)ethenyl]-2,5-dithiophen-2-ylthiophene |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2cc(-c3cccs3)sc2-c2cccs2)cc1 |
| InChI | InChI=1S/C20H13NO2S3/c22-21(23)16-9-6-14(7-10-16)5-8-15-13-19(17-3-1-11-24-17)26-20(15)18-4-2-12-25-18/h1-13H |
| InChIKey | XQLHTAXEQZLEFT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|