C11H22O3 — CID 71369247
6-methoxy-2,5,6-trimethylhept-3-ene-2,5-diol (PubChem CID 71369247) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 6-methoxy-2,5,6-trimethylhept-3-ene-2,5-diol.
| Compound Name | 6-methoxy-2,5,6-trimethylhept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 71369247 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 6-methoxy-2,5,6-trimethylhept-3-ene-2,5-diol |
| SMILES | COC(C)(C)C(C)(O)C=CC(C)(C)O |
| InChI | InChI=1S/C11H22O3/c1-9(2,12)7-8-11(5,13)10(3,4)14-6/h7-8,12-13H,1-6H3 |
| InChIKey | LFKQDJAMYUQXLJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|