C8H14I2N2O4 — CID 71391735
2,7-diiodo-1,8-dinitrooctane (PubChem CID 71391735) has the molecular formula C8H14I2N2O4 and a molecular weight of 456.02 g/mol. Its IUPAC name is 2,7-diiodo-1,8-dinitrooctane.
| Compound Name | 2,7-diiodo-1,8-dinitrooctane |
|---|---|
| PubChem CID | 71391735 |
| Molecular Formula | C8H14I2N2O4 |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 455.90 |
| IUPAC Name | 2,7-diiodo-1,8-dinitrooctane |
| SMILES | O=[N+]([O-])CC(I)CCCCC(I)C[N+](=O)[O-] |
| InChI | InChI=1S/C8H14I2N2O4/c9-7(5-11(13)14)3-1-2-4-8(10)6-12(15)16/h7-8H,1-6H2 |
| InChIKey | OFCQZRLGIAYOHS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|