C6H10N4O8 — CID 119097401
1,1,6,6-tetranitrohexane (PubChem CID 119097401) has the molecular formula C6H10N4O8 and a molecular weight of 266.17 g/mol. Its IUPAC name is 1,1,6,6-tetranitrohexane.
| Compound Name | 1,1,6,6-tetranitrohexane |
|---|---|
| PubChem CID | 119097401 |
| Molecular Formula | C6H10N4O8 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1,1,6,6-tetranitrohexane |
| SMILES | O=[N+]([O-])C(CCCCC([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N4O8/c11-7(12)5(8(13)14)3-1-2-4-6(9(15)16)10(17)18/h5-6H,1-4H2 |
| InChIKey | SPGGLSVQPIGQBA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|