About 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol
1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol (PubChem CID 71392493) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol |
| PubChem CID | 71392493 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol |
| SMILES | CC1(O)CC(C)(O)C[N+]([O-])(C2CCCCC2)C1 |
| InChI | InChI=1S/C13H25NO3/c1-12(15)8-13(2,16)10-14(17,9-12)11-6-4-3-5-7-11/h11,15-16H,3-10H2,1-2H3 |
| InChIKey | ABUJCNYPQSUKCL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol?
The IUPAC name of 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol (CID 71392493) is 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol.
What is the SMILES notation for 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol?
The canonical SMILES for 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol is CC1(O)CC(C)(O)C[N+]([O-])(C2CCCCC2)C1.
What is the InChIKey of 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol?
The InChIKey is ABUJCNYPQSUKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-12(15)8-13(2,16)10-14(17,9-12)11-6-4-3-5-7-11/h11,15-16H,3-10H2,1-2H3.
What are the key properties of 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol?
1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol has a molecular weight of 243.35 g/mol, XLogP of 1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol is sourced from PubChem (CID 71392493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).