C13H25NO3 — CID 71392493
1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol (PubChem CID 71392493) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol.
| Compound Name | 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol |
|---|---|
| PubChem CID | 71392493 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-cyclohexyl-3,5-dimethyl-1-oxidopiperidin-1-ium-3,5-diol |
| SMILES | CC1(O)CC(C)(O)C[N+]([O-])(C2CCCCC2)C1 |
| InChI | InChI=1S/C13H25NO3/c1-12(15)8-13(2,16)10-14(17,9-12)11-6-4-3-5-7-11/h11,15-16H,3-10H2,1-2H3 |
| InChIKey | ABUJCNYPQSUKCL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|