C17H12Cl2NO4- — CID 7140043
(E)-3-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]prop-2-enoate (PubChem CID 7140043) has the molecular formula C17H12Cl2NO4- and a molecular weight of 365.19 g/mol. Its IUPAC name is (E)-3-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]prop-2-enoate.
| Compound Name | (E)-3-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7140043 |
| Molecular Formula | C17H12Cl2NO4- |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (E)-3-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1ccc(OCC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H13Cl2NO4/c18-12-7-13(19)9-14(8-12)20-16(21)10-24-15-4-1-11(2-5-15)3-6-17(22)23/h1-9H,10H2,(H,20,21)(H,22,23)/p-1/b6-3+ |
| InChIKey | JBFHYWLZKDNIGV-ZZXKWVIFSA-M |
| XLogP | 2.77 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|