C22H45NO2 — CID 71406649
N,N-bis(2-ethylhexyl)-4-hydroxyhexanamide (PubChem CID 71406649) has the molecular formula C22H45NO2 and a molecular weight of 355.61 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-4-hydroxyhexanamide.
| Compound Name | N,N-bis(2-ethylhexyl)-4-hydroxyhexanamide |
|---|---|
| PubChem CID | 71406649 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-4-hydroxyhexanamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)CCC(O)CC |
| InChI | InChI=1S/C22H45NO2/c1-6-11-13-19(8-3)17-23(18-20(9-4)14-12-7-2)22(25)16-15-21(24)10-5/h19-21,24H,6-18H2,1-5H3 |
| InChIKey | NHMJCWKERKOZML-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |