C6H11BrO2 — CID 71407671
trans-(1R,2S)-1-bromo-2-(dimethoxymethyl)cyclopropane (PubChem CID 71407671) has the molecular formula C6H11BrO2 and a molecular weight of 195.06 g/mol. Its IUPAC name is trans-(1R,2S)-1-bromo-2-(dimethoxymethyl)cyclopropane.
| Compound Name | trans-(1R,2S)-1-bromo-2-(dimethoxymethyl)cyclopropane |
|---|---|
| PubChem CID | 71407671 |
| Molecular Formula | C6H11BrO2 |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | trans-(1R,2S)-1-bromo-2-(dimethoxymethyl)cyclopropane |
| SMILES | COC(OC)[C@@H]1C[C@H]1Br |
| InChI | InChI=1S/C6H11BrO2/c1-8-6(9-2)4-3-5(4)7/h4-6H,3H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | ISEXTDNGUAALQN-RFZPGFLSSA-N |
| XLogP | 1.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|