C12H22Cl4O — CID 71421457
1,4-dichloro-5-(2,5-dichloro-4-methylpentoxy)-2-methylpentane (PubChem CID 71421457) has the molecular formula C12H22Cl4O and a molecular weight of 324.12 g/mol. Its IUPAC name is 1,4-dichloro-5-(2,5-dichloro-4-methylpentoxy)-2-methylpentane.
| Compound Name | 1,4-dichloro-5-(2,5-dichloro-4-methylpentoxy)-2-methylpentane |
|---|---|
| PubChem CID | 71421457 |
| Molecular Formula | C12H22Cl4O |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1,4-dichloro-5-(2,5-dichloro-4-methylpentoxy)-2-methylpentane |
| SMILES | CC(CCl)CC(Cl)COCC(Cl)CC(C)CCl |
| InChI | InChI=1S/C12H22Cl4O/c1-9(5-13)3-11(15)7-17-8-12(16)4-10(2)6-14/h9-12H,3-8H2,1-2H3 |
| InChIKey | JVQQEWDINIQPQR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|