C14H15N6O4 — CID 71434270
CID 71434270 (PubChem CID 71434270) has the molecular formula C14H15N6O4 and a molecular weight of 331.31 g/mol.
| Compound Name | CID 71434270 |
|---|---|
| PubChem CID | 71434270 |
| Molecular Formula | C14H15N6O4 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | — |
| SMILES | CC[C@@H](NC(=O)Nc1ncnc2c1ncn2[C@H]1[CH][CH][CH]O1)C(=O)O |
| InChI | InChI=1S/C14H15N6O4/c1-2-8(13(21)22)18-14(23)19-11-10-12(16-6-15-11)20(7-17-10)9-4-3-5-24-9/h3-9H,2H2,1H3,(H,21,22)(H2,15,16,18,19,23)/t8-,9-/m1/s1 |
| InChIKey | QXBQTBWLEDHCAH-RKDXNWHRSA-N |
| XLogP | 0.91 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |