C7H7FO4 — CID 71436392
7-fluoro-2-hydroxy-6-oxohepta-2,4-dienoic acid (PubChem CID 71436392) has the molecular formula C7H7FO4 and a molecular weight of 174.13 g/mol. Its IUPAC name is 7-fluoro-2-hydroxy-6-oxohepta-2,4-dienoic acid.
| Compound Name | 7-fluoro-2-hydroxy-6-oxohepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 71436392 |
| Molecular Formula | C7H7FO4 |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 7-fluoro-2-hydroxy-6-oxohepta-2,4-dienoic acid |
| SMILES | O=C(C=CC=C(O)C(=O)O)CF |
| InChI | InChI=1S/C7H7FO4/c8-4-5(9)2-1-3-6(10)7(11)12/h1-3,10H,4H2,(H,11,12) |
| InChIKey | JRWGBOBMIFUCBF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|