C20H22N2O4 — CID 71450339
(2S)-2-(phenylmethoxymethylamino)-3-[4-(prop-2-enoylamino)phenyl]propanoic acid (PubChem CID 71450339) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2S)-2-(phenylmethoxymethylamino)-3-[4-(prop-2-enoylamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-(phenylmethoxymethylamino)-3-[4-(prop-2-enoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 71450339 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (2S)-2-(phenylmethoxymethylamino)-3-[4-(prop-2-enoylamino)phenyl]propanoic acid |
| SMILES | C=CC(=O)Nc1ccc(C[C@H](NCOCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-2-19(23)22-17-10-8-15(9-11-17)12-18(20(24)25)21-14-26-13-16-6-4-3-5-7-16/h2-11,18,21H,1,12-14H2,(H,22,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | YTYSTYWHKYYHFG-SFHVURJKSA-N |
| XLogP | 2.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|