C15H9Cl2NS — CID 71450754
2-(2,5-dichlorophenyl)-4-phenyl-1,3-thiazole (PubChem CID 71450754) has the molecular formula C15H9Cl2NS and a molecular weight of 306.22 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(2,5-dichlorophenyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 71450754 |
| Molecular Formula | C15H9Cl2NS |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-4-phenyl-1,3-thiazole |
| SMILES | Clc1ccc(Cl)c(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C15H9Cl2NS/c16-11-6-7-13(17)12(8-11)15-18-14(9-19-15)10-4-2-1-3-5-10/h1-9H |
| InChIKey | MFZYMZIUKNNZSG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |