C22H26ClN3O2S — CID 71453739
N-[5-(6-chloroindol-1-yl)sulfonyl-2-ethylphenyl]-1-methylpiperidin-4-amine (PubChem CID 71453739) has the molecular formula C22H26ClN3O2S and a molecular weight of 431.99 g/mol. Its IUPAC name is N-[5-(6-chloroindol-1-yl)sulfonyl-2-ethylphenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[5-(6-chloroindol-1-yl)sulfonyl-2-ethylphenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 71453739 |
| Molecular Formula | C22H26ClN3O2S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[5-(6-chloroindol-1-yl)sulfonyl-2-ethylphenyl]-1-methylpiperidin-4-amine |
| SMILES | CCc1ccc(S(=O)(=O)n2ccc3ccc(Cl)cc32)cc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C22H26ClN3O2S/c1-3-16-5-7-20(15-21(16)24-19-9-11-25(2)12-10-19)29(27,28)26-13-8-17-4-6-18(23)14-22(17)26/h4-8,13-15,19,24H,3,9-12H2,1-2H3 |
| InChIKey | SBYIYEABEHQHQQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |