C44H42N4O4 — CID 71453835
1,2-bis(9,9-dimethyl-7-oxo-6-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione (PubChem CID 71453835) has the molecular formula C44H42N4O4 and a molecular weight of 690.84 g/mol. Its IUPAC name is 1,2-bis(9,9-dimethyl-7-oxo-6-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(9,9-dimethyl-7-oxo-6-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71453835 |
| Molecular Formula | C44H42N4O4 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | 1,2-bis(9,9-dimethyl-7-oxo-6-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(C(=O)C(=O)N1c3ccccc3NC3=C(C(=O)CC(C)(C)C3)C1c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C44H42N4O4/c1-43(2)23-31-37(35(49)25-43)39(27-15-7-5-8-16-27)47(33-21-13-11-19-29(33)45-31)41(51)42(52)48-34-22-14-12-20-30(34)46-32-24-44(3,4)26-36(50)38(32)40(48)28-17-9-6-10-18-28/h5-22,39-40,45-46H,23-26H2,1-4H3 |
| InChIKey | ZZOKRSQSLSCEAE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|