C17H11N5O6 — CID 71454913
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 71454913) has the molecular formula C17H11N5O6 and a molecular weight of 381.30 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 71454913 |
| Molecular Formula | C17H11N5O6 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccc2c(c1)OCO2)c1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C17H11N5O6/c23-16(20-18-8-10-1-6-13-14(7-10)27-9-26-13)17-19-15(21-28-17)11-2-4-12(5-3-11)22(24)25/h1-8H,9H2,(H,20,23)/b18-8+ |
| InChIKey | NTMGEUMFNWLGGY-QGMBQPNBSA-N |
| XLogP | 2.14 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|