C12H14BrNO2 — CID 7145688
(2S,4R)-4-[(3-bromophenyl)methyl]pyrrolidin-1-ium-2-carboxylate (PubChem CID 7145688) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is (2S,4R)-4-[(3-bromophenyl)methyl]pyrrolidin-1-ium-2-carboxylate.
| Compound Name | (2S,4R)-4-[(3-bromophenyl)methyl]pyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7145688 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (2S,4R)-4-[(3-bromophenyl)methyl]pyrrolidin-1-ium-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@@H](Cc2cccc(Br)c2)C[NH2+]1 |
| InChI | InChI=1S/C12H14BrNO2/c13-10-3-1-2-8(5-10)4-9-6-11(12(15)16)14-7-9/h1-3,5,9,11,14H,4,6-7H2,(H,15,16)/t9-,11+/m1/s1 |
| InChIKey | VBTFDJIIOZOILN-KOLCDFICSA-N |
| XLogP | -0.31 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |