C17H16Cl3N5 — CID 71464804
2-(5-benzyl-1H-imidazol-2-yl)-1-(3,4-dichlorophenyl)guanidine;hydrochloride (PubChem CID 71464804) has the molecular formula C17H16Cl3N5 and a molecular weight of 396.71 g/mol. Its IUPAC name is 2-(5-benzyl-1H-imidazol-2-yl)-1-(3,4-dichlorophenyl)guanidine;hydrochloride.
| Compound Name | 2-(5-benzyl-1H-imidazol-2-yl)-1-(3,4-dichlorophenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 71464804 |
| Molecular Formula | C17H16Cl3N5 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-(5-benzyl-1H-imidazol-2-yl)-1-(3,4-dichlorophenyl)guanidine;hydrochloride |
| SMILES | Cl.N/C(=N/c1ncc(Cc2ccccc2)[nH]1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N5.ClH/c18-14-7-6-12(9-15(14)19)22-16(20)24-17-21-10-13(23-17)8-11-4-2-1-3-5-11;/h1-7,9-10H,8H2,(H4,20,21,22,23,24);1H |
| InChIKey | REJBHXIRXFCEFY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|