C20H27N3O5 — CID 71466712
methyl (1R,4aS)-6-(2-aminoethylamino)-1,4a-dimethyl-7-nitro-9-oxo-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 71466712) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is methyl (1R,4aS)-6-(2-aminoethylamino)-1,4a-dimethyl-7-nitro-9-oxo-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS)-6-(2-aminoethylamino)-1,4a-dimethyl-7-nitro-9-oxo-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 71466712 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | methyl (1R,4aS)-6-(2-aminoethylamino)-1,4a-dimethyl-7-nitro-9-oxo-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(NCCN)c([N+](=O)[O-])cc3C(=O)CC12 |
| InChI | InChI=1S/C20H27N3O5/c1-19-5-4-6-20(2,18(25)28-3)17(19)11-16(24)12-9-15(23(26)27)14(10-13(12)19)22-8-7-21/h9-10,17,22H,4-8,11,21H2,1-3H3/t17?,19-,20-/m1/s1 |
| InChIKey | LENJHTDFGZJYCE-IPNZSQQUSA-N |
| XLogP | 2.79 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|