C24H28NO4+ — CID 123259876
methyl (1S,4aS,10aR)-1,4a-dimethyl-9-oxo-6-(pyridin-1-ium-3-ylmethoxy)-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 123259876) has the molecular formula C24H28NO4+ and a molecular weight of 394.49 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-1,4a-dimethyl-9-oxo-6-(pyridin-1-ium-3-ylmethoxy)-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-9-oxo-6-(pyridin-1-ium-3-ylmethoxy)-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 123259876 |
| Molecular Formula | C24H28NO4+ |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-9-oxo-6-(pyridin-1-ium-3-ylmethoxy)-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(OCc4ccc[nH+]c4)ccc3C(=O)C[C@@H]12 |
| InChI | InChI=1S/C24H27NO4/c1-23-9-5-10-24(2,22(27)28-3)21(23)13-20(26)18-8-7-17(12-19(18)23)29-15-16-6-4-11-25-14-16/h4,6-8,11-12,14,21H,5,9-10,13,15H2,1-3H3/p+1/t21-,23-,24+/m1/s1 |
| InChIKey | WVZNNTOAKMVZTM-JRFVFWCSSA-O |
| XLogP | 3.90 |
| TPSA | 66.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |