C18H23N4O3PPd — CID 71466986
(E)-4-oxopent-2-en-2-olate;palladium(2+);N-(1,3,5-triaza-7λ5-phosphatricyclo[3.3.1.13,7]decan-7-ylidene)benzamide (PubChem CID 71466986) has the molecular formula C18H23N4O3PPd and a molecular weight of 480.80 g/mol. Its IUPAC name is (E)-4-oxopent-2-en-2-olate;palladium(2+);N-(1,3,5-triaza-7λ5-phosphatricyclo[3.3.1.13,7]decan-7-ylidene)benzamide.
| Compound Name | (E)-4-oxopent-2-en-2-olate;palladium(2+);N-(1,3,5-triaza-7λ5-phosphatricyclo[3.3.1.13,7]decan-7-ylidene)benzamide |
|---|---|
| PubChem CID | 71466986 |
| Molecular Formula | C18H23N4O3PPd |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | (E)-4-oxopent-2-en-2-olate;palladium(2+);N-(1,3,5-triaza-7λ5-phosphatricyclo[3.3.1.13,7]decan-7-ylidene)benzamide |
| SMILES | CC(=O)/C=C(\C)[O-].O=C(N=P12CN3CN(CN(C3)C1)C2)c1[c-]cccc1.[Pd+2] |
| InChI | InChI=1S/C13H16N4OP.C5H8O2.Pd/c18-13(12-4-2-1-3-5-12)14-19-9-15-6-16(10-19)8-17(7-15)11-19;1-4(6)3-5(2)7;/h1-4H,6-11H2;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3+; |
| InChIKey | OZPMBXBLVFKJLF-ITDJAWRYSA-M |
| XLogP | 1.36 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|