C22H27NO3 — CID 71475581
(2E)-N,N-diethyl-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide (PubChem CID 71475581) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (2E)-N,N-diethyl-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide.
| Compound Name | (2E)-N,N-diethyl-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide |
|---|---|
| PubChem CID | 71475581 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2E)-N,N-diethyl-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide |
| SMILES | CCCC/C(=C\C1=C(C)C(=O)c2ccccc2C1=O)C(=O)N(CC)CC |
| InChI | InChI=1S/C22H27NO3/c1-5-8-11-16(22(26)23(6-2)7-3)14-19-15(4)20(24)17-12-9-10-13-18(17)21(19)25/h9-10,12-14H,5-8,11H2,1-4H3/b16-14+ |
| InChIKey | RQQHSEWQWCGXJX-JQIJEIRASA-N |
| XLogP | 4.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|