C18H19NO3 — CID 71475609
(2E)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide (PubChem CID 71475609) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2E)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide.
| Compound Name | (2E)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide |
|---|---|
| PubChem CID | 71475609 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2E)-2-[(3-methyl-1,4-dioxonaphthalen-2-yl)methylidene]hexanamide |
| SMILES | CCCC/C(=C\C1=C(C)C(=O)c2ccccc2C1=O)C(N)=O |
| InChI | InChI=1S/C18H19NO3/c1-3-4-7-12(18(19)22)10-15-11(2)16(20)13-8-5-6-9-14(13)17(15)21/h5-6,8-10H,3-4,7H2,1-2H3,(H2,19,22)/b12-10+ |
| InChIKey | ZAOKQVDGEFESAD-ZRDIBKRKSA-N |
| XLogP | 2.98 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|