C22H27FN7O8P — CID 71478357
[3-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-9-yl] propanoate (PubChem CID 71478357) has the molecular formula C22H27FN7O8P and a molecular weight of 567.47 g/mol. Its IUPAC name is [3-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-9-yl] propanoate.
| Compound Name | [3-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-9-yl] propanoate |
|---|---|
| PubChem CID | 71478357 |
| Molecular Formula | C22H27FN7O8P |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | [3-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-9-yl] propanoate |
| SMILES | CCC(=O)Oc1c(C)ncc2c1COP(=O)(OC[C@H]1O[C@@H](n3cnc4c(N)nc(N)nc43)[C@@](C)(F)[C@H]1O)OC2 |
| InChI | InChI=1S/C22H27FN7O8P/c1-4-14(31)38-16-10(2)26-5-11-6-34-39(33,35-7-12(11)16)36-8-13-17(32)22(3,23)20(37-13)30-9-27-15-18(24)28-21(25)29-19(15)30/h5,9,13,17,20,32H,4,6-8H2,1-3H3,(H4,24,25,28,29)/t13-,17+,20-,22+,39?/m1/s1 |
| InChIKey | QCFUPSIQLSURFW-VGAHSTEISA-N |
| XLogP | 1.87 |
| TPSA | 209.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|