C21H44O3Si2 — CID 71484677
ethyl (2Z)-3-triethylsilyloxy-2-(trimethylsilylmethylidene)nonanoate (PubChem CID 71484677) has the molecular formula C21H44O3Si2 and a molecular weight of 400.75 g/mol. Its IUPAC name is ethyl (2Z)-3-triethylsilyloxy-2-(trimethylsilylmethylidene)nonanoate.
| Compound Name | ethyl (2Z)-3-triethylsilyloxy-2-(trimethylsilylmethylidene)nonanoate |
|---|---|
| PubChem CID | 71484677 |
| Molecular Formula | C21H44O3Si2 |
| Molecular Weight | 400.75 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | ethyl (2Z)-3-triethylsilyloxy-2-(trimethylsilylmethylidene)nonanoate |
| SMILES | CCCCCCC(O[Si](CC)(CC)CC)/C(=C/[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C21H44O3Si2/c1-9-14-15-16-17-20(24-26(11-3,12-4)13-5)19(18-25(6,7)8)21(22)23-10-2/h18,20H,9-17H2,1-8H3/b19-18- |
| InChIKey | LYJOEJAMMYQXST-HNENSFHCSA-N |
| XLogP | 6.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|