C39H44N2O6 — CID 71485198
(2S)-N-[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 71485198) has the molecular formula C39H44N2O6 and a molecular weight of 636.79 g/mol. Its IUPAC name is (2S)-N-[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71485198 |
| Molecular Formula | C39H44N2O6 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | (2S)-N-[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@H]1[C@H](OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C39H44N2O6/c42-38(33-22-13-23-40-33)41-35-37(45-26-31-18-9-3-10-19-31)36(44-25-30-16-7-2-8-17-30)34(28-43-24-29-14-5-1-6-15-29)47-39(35)46-27-32-20-11-4-12-21-32/h1-12,14-21,33-37,39-40H,13,22-28H2,(H,41,42)/t33-,34+,35+,36+,37+,39+/m0/s1 |
| InChIKey | CKRVNPPSADJEIN-CFDVCCJCSA-N |
| XLogP | 5.55 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |