C22H13Cl2KN4O3S2 — CID 71486149
potassium [2-benzylsulfanyl-4-chloro-5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonyl-cyanoazanide (PubChem CID 71486149) has the molecular formula C22H13Cl2KN4O3S2 and a molecular weight of 555.51 g/mol. Its IUPAC name is potassium [2-benzylsulfanyl-4-chloro-5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonyl-cyanoazanide.
| Compound Name | potassium [2-benzylsulfanyl-4-chloro-5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonyl-cyanoazanide |
|---|---|
| PubChem CID | 71486149 |
| Molecular Formula | C22H13Cl2KN4O3S2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 553.94 |
| IUPAC Name | potassium [2-benzylsulfanyl-4-chloro-5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]phenyl]sulfonyl-cyanoazanide |
| SMILES | N#C[N-]S(=O)(=O)c1cc(-c2nc(-c3ccc(Cl)cc3)no2)c(Cl)cc1SCc1ccccc1.[K+] |
| InChI | InChI=1S/C22H13Cl2N4O3S2.K/c23-16-8-6-15(7-9-16)21-27-22(31-28-21)17-10-20(33(29,30)26-13-25)19(11-18(17)24)32-12-14-4-2-1-3-5-14;/h1-11H,12H2;/q-1;+1 |
| InChIKey | JEYOEWYRMMBMMC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 110.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|