C31H32ClN7O3 — CID 71498353
tert-butyl N-[2-[4-[2-[2-amino-4-[4-carbamoyl-5-(5-chloro-2-methylphenyl)-1H-pyrrol-2-yl]pyrimidin-5-yl]ethynyl]anilino]ethyl]carbamate (PubChem CID 71498353) has the molecular formula C31H32ClN7O3 and a molecular weight of 586.10 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-[2-amino-4-[4-carbamoyl-5-(5-chloro-2-methylphenyl)-1H-pyrrol-2-yl]pyrimidin-5-yl]ethynyl]anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-[2-amino-4-[4-carbamoyl-5-(5-chloro-2-methylphenyl)-1H-pyrrol-2-yl]pyrimidin-5-yl]ethynyl]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 71498353 |
| Molecular Formula | C31H32ClN7O3 |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | tert-butyl N-[2-[4-[2-[2-amino-4-[4-carbamoyl-5-(5-chloro-2-methylphenyl)-1H-pyrrol-2-yl]pyrimidin-5-yl]ethynyl]anilino]ethyl]carbamate |
| SMILES | Cc1ccc(Cl)cc1-c1[nH]c(-c2nc(N)ncc2C#Cc2ccc(NCCNC(=O)OC(C)(C)C)cc2)cc1C(N)=O |
| InChI | InChI=1S/C31H32ClN7O3/c1-18-5-10-21(32)15-23(18)27-24(28(33)40)16-25(38-27)26-20(17-37-29(34)39-26)9-6-19-7-11-22(12-8-19)35-13-14-36-30(41)42-31(2,3)4/h5,7-8,10-12,15-17,35,38H,13-14H2,1-4H3,(H2,33,40)(H,36,41)(H2,34,37,39) |
| InChIKey | KIHMCBUAJIJJFJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 161.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|