C30H34Cl4N8O6 — CID 71501852
1,2,3,4-tetrachloro-6,9-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]phenazine (PubChem CID 71501852) has the molecular formula C30H34Cl4N8O6 and a molecular weight of 744.46 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-6,9-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]phenazine.
| Compound Name | 1,2,3,4-tetrachloro-6,9-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]phenazine |
|---|---|
| PubChem CID | 71501852 |
| Molecular Formula | C30H34Cl4N8O6 |
| Molecular Weight | 744.46 g/mol |
| Exact Mass | 742.14 |
| IUPAC Name | 1,2,3,4-tetrachloro-6,9-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]phenazine |
| SMILES | COCCOCCOCCn1cc(-c2ccc(-c3cn(CCOCCOCCOC)nn3)c3nc4c(Cl)c(Cl)c(Cl)c(Cl)c4nc23)nn1 |
| InChI | InChI=1S/C30H34Cl4N8O6/c1-43-9-11-47-15-13-45-7-5-41-17-21(37-39-41)19-3-4-20(22-18-42(40-38-22)6-8-46-14-16-48-12-10-44-2)28-27(19)35-29-25(33)23(31)24(32)26(34)30(29)36-28/h3-4,17-18H,5-16H2,1-2H3 |
| InChIKey | MHMKRHBPZXYDAI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|