C30H47NO4 — CID 71507060
benzyl (2S,5R)-2-[(1S)-1-hydroxyheptyl]-5-[(E)-4-oxoundec-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 71507060) has the molecular formula C30H47NO4 and a molecular weight of 485.71 g/mol. Its IUPAC name is benzyl (2S,5R)-2-[(1S)-1-hydroxyheptyl]-5-[(E)-4-oxoundec-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,5R)-2-[(1S)-1-hydroxyheptyl]-5-[(E)-4-oxoundec-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71507060 |
| Molecular Formula | C30H47NO4 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | benzyl (2S,5R)-2-[(1S)-1-hydroxyheptyl]-5-[(E)-4-oxoundec-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCC(=O)/C=C/C[C@H]1CC[C@@H]([C@@H](O)CCCCCC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H47NO4/c1-3-5-7-9-13-19-27(32)20-15-18-26-22-23-28(29(33)21-14-8-6-4-2)31(26)30(34)35-24-25-16-11-10-12-17-25/h10-12,15-17,20,26,28-29,33H,3-9,13-14,18-19,21-24H2,1-2H3/b20-15+/t26-,28-,29-/m0/s1 |
| InChIKey | SLNMNIDECQMKQK-QXMVQNRFSA-N |
| XLogP | 7.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|