C27H33NO7 — CID 71507087
[(1S,8S)-8-[3-[(3,4-dimethoxyphenyl)methoxy]propoxy]-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizin-1-yl]methyl benzoate (PubChem CID 71507087) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is [(1S,8S)-8-[3-[(3,4-dimethoxyphenyl)methoxy]propoxy]-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizin-1-yl]methyl benzoate.
| Compound Name | [(1S,8S)-8-[3-[(3,4-dimethoxyphenyl)methoxy]propoxy]-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 71507087 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [(1S,8S)-8-[3-[(3,4-dimethoxyphenyl)methoxy]propoxy]-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizin-1-yl]methyl benzoate |
| SMILES | COc1ccc(COCCCO[C@]23CCC(=O)N2CC[C@H]3COC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H33NO7/c1-31-23-10-9-20(17-24(23)32-2)18-33-15-6-16-35-27-13-11-25(29)28(27)14-12-22(27)19-34-26(30)21-7-4-3-5-8-21/h3-5,7-10,17,22H,6,11-16,18-19H2,1-2H3/t22-,27-/m0/s1 |
| InChIKey | CQOCIZAEENYHKS-CUNXSJBXSA-N |
| XLogP | 3.82 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|