About 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid
1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid (PubChem CID 71517505) has the molecular formula C13H11F3N4O6S
and a molecular weight of 408.31 g/mol. Its IUPAC name is 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid |
| PubChem CID | 71517505 |
| Molecular Formula | C13H11F3N4O6S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid |
| SMILES | O=C(O)c1nnn(CCNS(=O)(=O)c2ccccc2C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C13H11F3N4O6S/c14-13(15,16)7-3-1-2-4-8(7)27(25,26)17-5-6-20-10(12(23)24)9(11(21)22)18-19-20/h1-4,17H,5-6H2,(H,21,22)(H,23,24) |
| InChIKey | UJCVYAXJWLRQKQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid?
The IUPAC name of 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid (CID 71517505) is 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid.
What is the SMILES notation for 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid?
The canonical SMILES for 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid is O=C(O)c1nnn(CCNS(=O)(=O)c2ccccc2C(F)(F)F)c1C(=O)O.
What is the InChIKey of 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid?
The InChIKey is UJCVYAXJWLRQKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N4O6S/c14-13(15,16)7-3-1-2-4-8(7)27(25,26)17-5-6-20-10(12(23)24)9(11(21)22)18-19-20/h1-4,17H,5-6H2,(H,21,22)(H,23,24).
What are the key properties of 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid?
1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid has a molecular weight of 408.31 g/mol, XLogP of 0.67, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]triazole-4,5-dicarboxylic acid is sourced from PubChem (CID 71517505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).