C23H28N4O5 — CID 71520035
N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(4-methylpiperazine-1-carbonyl)benzamide (PubChem CID 71520035) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(4-methylpiperazine-1-carbonyl)benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(4-methylpiperazine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 71520035 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(4-methylpiperazine-1-carbonyl)benzamide |
| SMILES | CN1CCN(C(=O)c2cccc(C(=O)N[C@@H](Cc3ccccc3)[C@H](O)C[N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H28N4O5/c1-25-10-12-26(13-11-25)23(30)19-9-5-8-18(15-19)22(29)24-20(21(28)16-27(31)32)14-17-6-3-2-4-7-17/h2-9,15,20-21,28H,10-14,16H2,1H3,(H,24,29)/t20-,21+/m0/s1 |
| InChIKey | PBUXXTBVXIFJAS-LEWJYISDSA-N |
| XLogP | 1.05 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|