C22H25N3O5 — CID 71520038
N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(pyrrolidine-1-carbonyl)benzamide (PubChem CID 71520038) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(pyrrolidine-1-carbonyl)benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(pyrrolidine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 71520038 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-3-(pyrrolidine-1-carbonyl)benzamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)C[N+](=O)[O-])c1cccc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H25N3O5/c26-20(15-25(29)30)19(13-16-7-2-1-3-8-16)23-21(27)17-9-6-10-18(14-17)22(28)24-11-4-5-12-24/h1-3,6-10,14,19-20,26H,4-5,11-13,15H2,(H,23,27)/t19-,20+/m0/s1 |
| InChIKey | XBBXUVNFXYGWNZ-VQTJNVASSA-N |
| XLogP | 1.90 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|