C23H30N4O4 — CID 71520067
N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide (PubChem CID 71520067) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 71520067 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[(1-methylpiperidin-4-yl)amino]benzamide |
| SMILES | CN1CCC(Nc2ccc(C(=O)N[C@@H](Cc3ccccc3)[C@H](O)C[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H30N4O4/c1-26-13-11-20(12-14-26)24-19-9-7-18(8-10-19)23(29)25-21(22(28)16-27(30)31)15-17-5-3-2-4-6-17/h2-10,20-22,24,28H,11-16H2,1H3,(H,25,29)/t21-,22+/m0/s1 |
| InChIKey | WNZZRLCWYHNVET-FCHUYYIVSA-N |
| XLogP | 2.17 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|